C40H35Cl4NO2Si — CID 71589861
tert-butyl-[2-[6-chloro-4-(2-chlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]quinolin-3-yl]ethoxy]-diphenylsilane (PubChem CID 71589861) has the molecular formula C40H35Cl4NO2Si and a molecular weight of 731.62 g/mol. Its IUPAC name is tert-butyl-[2-[6-chloro-4-(2-chlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]quinolin-3-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[6-chloro-4-(2-chlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]quinolin-3-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 71589861 |
| Molecular Formula | C40H35Cl4NO2Si |
| Molecular Weight | 731.62 g/mol |
| Exact Mass | 729.12 |
| IUPAC Name | tert-butyl-[2-[6-chloro-4-(2-chlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]quinolin-3-yl]ethoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCc1c(OCc2c(Cl)cccc2Cl)nc2ccc(Cl)cc2c1-c1ccccc1Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H35Cl4NO2Si/c1-40(2,3)48(28-13-6-4-7-14-28,29-15-8-5-9-16-29)47-24-23-31-38(30-17-10-11-18-34(30)42)32-25-27(41)21-22-37(32)45-39(31)46-26-33-35(43)19-12-20-36(33)44/h4-22,25H,23-24,26H2,1-3H3 |
| InChIKey | MAZNWYXMJQZUPT-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.62 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|