C40H35Cl2F2NOSi — CID 53318305
tert-butyl-[2-[6-chloro-4-(2-chlorophenyl)-2-[(2,6-difluorophenyl)methoxy]quinolin-3-yl]ethyl]-diphenylsilane (PubChem CID 53318305) has the molecular formula C40H35Cl2F2NOSi and a molecular weight of 682.71 g/mol. Its IUPAC name is tert-butyl-[2-[6-chloro-4-(2-chlorophenyl)-2-[(2,6-difluorophenyl)methoxy]quinolin-3-yl]ethyl]-diphenylsilane.
| Compound Name | tert-butyl-[2-[6-chloro-4-(2-chlorophenyl)-2-[(2,6-difluorophenyl)methoxy]quinolin-3-yl]ethyl]-diphenylsilane |
|---|---|
| PubChem CID | 53318305 |
| Molecular Formula | C40H35Cl2F2NOSi |
| Molecular Weight | 682.71 g/mol |
| Exact Mass | 681.18 |
| IUPAC Name | tert-butyl-[2-[6-chloro-4-(2-chlorophenyl)-2-[(2,6-difluorophenyl)methoxy]quinolin-3-yl]ethyl]-diphenylsilane |
| SMILES | CC(C)(C)[Si](CCc1c(OCc2c(F)cccc2F)nc2ccc(Cl)cc2c1-c1ccccc1Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H35Cl2F2NOSi/c1-40(2,3)47(28-13-6-4-7-14-28,29-15-8-5-9-16-29)24-23-31-38(30-17-10-11-18-34(30)42)32-25-27(41)21-22-37(32)45-39(31)46-26-33-35(43)19-12-20-36(33)44/h4-22,25H,23-24,26H2,1-3H3 |
| InChIKey | HEFKJCMMGJUBJT-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.71 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|