C34H30Cl2F3NO3SSi — CID 53318307
[3-[2-[tert-butyl(diphenyl)silyl]ethyl]-6-chloro-4-(2-chlorophenyl)quinolin-2-yl] trifluoromethanesulfonate (PubChem CID 53318307) has the molecular formula C34H30Cl2F3NO3SSi and a molecular weight of 688.67 g/mol. Its IUPAC name is [3-[2-[tert-butyl(diphenyl)silyl]ethyl]-6-chloro-4-(2-chlorophenyl)quinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [3-[2-[tert-butyl(diphenyl)silyl]ethyl]-6-chloro-4-(2-chlorophenyl)quinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 53318307 |
| Molecular Formula | C34H30Cl2F3NO3SSi |
| Molecular Weight | 688.67 g/mol |
| Exact Mass | 687.10 |
| IUPAC Name | [3-[2-[tert-butyl(diphenyl)silyl]ethyl]-6-chloro-4-(2-chlorophenyl)quinolin-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](CCc1c(OS(=O)(=O)C(F)(F)F)nc2ccc(Cl)cc2c1-c1ccccc1Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H30Cl2F3NO3SSi/c1-33(2,3)45(24-12-6-4-7-13-24,25-14-8-5-9-15-25)21-20-27-31(26-16-10-11-17-29(26)36)28-22-23(35)18-19-30(28)40-32(27)43-44(41,42)34(37,38)39/h4-19,22H,20-21H2,1-3H3 |
| InChIKey | FFCXTYWZUHQBQT-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.67 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|