C19H17Cl2NO6S2 — CID 53318304
2-[6-chloro-4-(2-chlorophenyl)-2-methylsulfonyloxyquinolin-3-yl]ethyl methanesulfonate (PubChem CID 53318304) has the molecular formula C19H17Cl2NO6S2 and a molecular weight of 490.39 g/mol. Its IUPAC name is 2-[6-chloro-4-(2-chlorophenyl)-2-methylsulfonyloxyquinolin-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[6-chloro-4-(2-chlorophenyl)-2-methylsulfonyloxyquinolin-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 53318304 |
| Molecular Formula | C19H17Cl2NO6S2 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | 2-[6-chloro-4-(2-chlorophenyl)-2-methylsulfonyloxyquinolin-3-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCc1c(OS(C)(=O)=O)nc2ccc(Cl)cc2c1-c1ccccc1Cl |
| InChI | InChI=1S/C19H17Cl2NO6S2/c1-29(23,24)27-10-9-14-18(13-5-3-4-6-16(13)21)15-11-12(20)7-8-17(15)22-19(14)28-30(2,25)26/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | QVYJGDZOQFVFEJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|