C32H36Cl2N2O2Si — CID 18321822
N-[[1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methyl]butanamide (PubChem CID 18321822) has the molecular formula C32H36Cl2N2O2Si and a molecular weight of 579.64 g/mol. Its IUPAC name is N-[[1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methyl]butanamide.
| Compound Name | N-[[1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 18321822 |
| Molecular Formula | C32H36Cl2N2O2Si |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | N-[[1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dichlorophenyl]pyrrol-2-yl]methyl]butanamide |
| SMILES | CCCC(=O)NCc1cccn1-c1ccc(Cl)c(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1Cl |
| InChI | InChI=1S/C32H36Cl2N2O2Si/c1-5-13-30(37)35-22-24-14-12-21-36(24)29-20-19-28(33)27(31(29)34)23-38-39(32(2,3)4,25-15-8-6-9-16-25)26-17-10-7-11-18-26/h6-12,14-21H,5,13,22-23H2,1-4H3,(H,35,37) |
| InChIKey | JQTCDEMAZGZSOC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|