C41H44N2O3SSi — CID 10532510
4-[(E)-3-[[3-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dimethylphenyl]thiophen-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 10532510) has the molecular formula C41H44N2O3SSi and a molecular weight of 672.97 g/mol. Its IUPAC name is 4-[(E)-3-[[3-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dimethylphenyl]thiophen-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[(E)-3-[[3-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dimethylphenyl]thiophen-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 10532510 |
| Molecular Formula | C41H44N2O3SSi |
| Molecular Weight | 672.97 g/mol |
| Exact Mass | 672.28 |
| IUPAC Name | 4-[(E)-3-[[3-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dimethylphenyl]thiophen-2-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)NCc2sccc2-c2ccc(C)c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2C)cc1 |
| InChI | InChI=1S/C41H44N2O3SSi/c1-29-17-23-35(36-25-26-47-38(36)27-43-39(44)24-20-31-18-21-32(22-19-31)40(45)42-6)30(2)37(29)28-46-48(41(3,4)5,33-13-9-7-10-14-33)34-15-11-8-12-16-34/h7-26H,27-28H2,1-6H3,(H,42,45)(H,43,44)/b24-20+ |
| InChIKey | JCGLBEWKLMJNMV-HIXSDJFHSA-N |
| XLogP | 7.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.97 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|