C40H42N3O3SSi — CID 173234022
CID 173234022 (PubChem CID 173234022) has the molecular formula C40H42N3O3SSi and a molecular weight of 672.95 g/mol.
| Compound Name | CID 173234022 |
|---|---|
| PubChem CID | 173234022 |
| Molecular Formula | C40H42N3O3SSi |
| Molecular Weight | 672.95 g/mol |
| Exact Mass | 672.27 |
| IUPAC Name | — |
| SMILES | CC(=O)Nc1ccc(C=CC(=O)NCc2sccc2-c2cc(CO[Si](c3ccccc3)c3ccccc3)c(C)c(C(C)(C)C)c2C)cn1 |
| InChI | InChI=1S/C40H42N3O3SSi/c1-27-31(26-46-48(32-13-9-7-10-14-32)33-15-11-8-12-16-33)23-35(28(2)39(27)40(4,5)6)34-21-22-47-36(34)25-42-38(45)20-18-30-17-19-37(41-24-30)43-29(3)44/h7-24H,25-26H2,1-6H3,(H,42,45)(H,41,43,44) |
| InChIKey | QKEGWOIYTYNNPQ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.95 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|