C15H20N2O5 — CID 144568230
ethane;(E)-3-[6-[(4-methoxy-4-oxobutanoyl)amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 144568230) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is ethane;(E)-3-[6-[(4-methoxy-4-oxobutanoyl)amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | ethane;(E)-3-[6-[(4-methoxy-4-oxobutanoyl)amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 144568230 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethane;(E)-3-[6-[(4-methoxy-4-oxobutanoyl)amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | CC.COC(=O)CCC(=O)Nc1ccc(/C=C/C(=O)O)cn1 |
| InChI | InChI=1S/C13H14N2O5.C2H6/c1-20-13(19)7-5-11(16)15-10-4-2-9(8-14-10)3-6-12(17)18;1-2/h2-4,6,8H,5,7H2,1H3,(H,17,18)(H,14,15,16);1-2H3/b6-3+; |
| InChIKey | JRCGQAQYNXQNIH-ZIKNSQGESA-N |
| XLogP | 2.10 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|