C11H13N3O4 — CID 89443941
methyl 4-[(5-acetylpyrazin-2-yl)amino]-4-oxobutanoate (PubChem CID 89443941) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl 4-[(5-acetylpyrazin-2-yl)amino]-4-oxobutanoate.
| Compound Name | methyl 4-[(5-acetylpyrazin-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 89443941 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | methyl 4-[(5-acetylpyrazin-2-yl)amino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Nc1cnc(C(C)=O)cn1 |
| InChI | InChI=1S/C11H13N3O4/c1-7(15)8-5-13-9(6-12-8)14-10(16)3-4-11(17)18-2/h5-6H,3-4H2,1-2H3,(H,13,14,16) |
| InChIKey | AVJVSCUGSQBOQY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |