C13H13N3O5 — CID 90061168
methyl 4-[[5-[(E)-3-nitroso-3-oxoprop-1-enyl]-2-pyridinyl]amino]-4-oxobutanoate (PubChem CID 90061168) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is methyl 4-[[5-[(E)-3-nitroso-3-oxoprop-1-enyl]-2-pyridinyl]amino]-4-oxobutanoate.
| Compound Name | methyl 4-[[5-[(E)-3-nitroso-3-oxoprop-1-enyl]-2-pyridinyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 90061168 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | methyl 4-[[5-[(E)-3-nitroso-3-oxoprop-1-enyl]-2-pyridinyl]amino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Nc1ccc(/C=C/C(=O)N=O)cn1 |
| InChI | InChI=1S/C13H13N3O5/c1-21-13(19)7-6-11(17)15-10-4-2-9(8-14-10)3-5-12(18)16-20/h2-5,8H,6-7H2,1H3,(H,14,15,17)/b5-3+ |
| InChIKey | GMQJRVAIWSGBOS-HWKANZROSA-N |
| XLogP | 1.28 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|