C15H20N2O3Si — CID 89444199
methyl 4-oxo-4-[[5-(2-trimethylsilylethynyl)-2-pyridinyl]amino]butanoate (PubChem CID 89444199) has the molecular formula C15H20N2O3Si and a molecular weight of 304.42 g/mol. Its IUPAC name is methyl 4-oxo-4-[[5-(2-trimethylsilylethynyl)-2-pyridinyl]amino]butanoate.
| Compound Name | methyl 4-oxo-4-[[5-(2-trimethylsilylethynyl)-2-pyridinyl]amino]butanoate |
|---|---|
| PubChem CID | 89444199 |
| Molecular Formula | C15H20N2O3Si |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl 4-oxo-4-[[5-(2-trimethylsilylethynyl)-2-pyridinyl]amino]butanoate |
| SMILES | COC(=O)CCC(=O)Nc1ccc(C#C[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C15H20N2O3Si/c1-20-15(19)8-7-14(18)17-13-6-5-12(11-16-13)9-10-21(2,3)4/h5-6,11H,7-8H2,1-4H3,(H,16,17,18) |
| InChIKey | LKYRJNRMQGQFFT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|