C9H11N3O3 — CID 110756659
methyl 4-oxo-4-(pyrimidin-2-ylamino)butanoate (PubChem CID 110756659) has the molecular formula C9H11N3O3 and a molecular weight of 209.21 g/mol. Its IUPAC name is methyl 4-oxo-4-(pyrimidin-2-ylamino)butanoate.
| Compound Name | methyl 4-oxo-4-(pyrimidin-2-ylamino)butanoate |
|---|---|
| PubChem CID | 110756659 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | methyl 4-oxo-4-(pyrimidin-2-ylamino)butanoate |
| SMILES | COC(=O)CCC(=O)Nc1ncccn1 |
| InChI | InChI=1S/C9H11N3O3/c1-15-8(14)4-3-7(13)12-9-10-5-2-6-11-9/h2,5-6H,3-4H2,1H3,(H,10,11,12,13) |
| InChIKey | UTVGSLBXPUKYKG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |