C49H57NO4Si2 — CID 10440239
tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxy-1-[[tert-butyl(diphenyl)silyl]oxymethyl]naphthalen-2-yl]-N-methylcarbamate (PubChem CID 10440239) has the molecular formula C49H57NO4Si2 and a molecular weight of 780.17 g/mol. Its IUPAC name is tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxy-1-[[tert-butyl(diphenyl)silyl]oxymethyl]naphthalen-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxy-1-[[tert-butyl(diphenyl)silyl]oxymethyl]naphthalen-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 10440239 |
| Molecular Formula | C49H57NO4Si2 |
| Molecular Weight | 780.17 g/mol |
| Exact Mass | 779.38 |
| IUPAC Name | tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxy-1-[[tert-butyl(diphenyl)silyl]oxymethyl]naphthalen-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1cc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c2ccccc2c1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C49H57NO4Si2/c1-47(2,3)53-46(51)50(10)44-35-45(54-56(49(7,8)9,39-29-19-13-20-30-39)40-31-21-14-22-32-40)42-34-24-23-33-41(42)43(44)36-52-55(48(4,5)6,37-25-15-11-16-26-37)38-27-17-12-18-28-38/h11-35H,36H2,1-10H3 |
| InChIKey | LQBSIQFVEUPZKF-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.17 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|