C24H28O5Si — CID 10971944
(4R,4aR,8aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4a,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-6-one (PubChem CID 10971944) has the molecular formula C24H28O5Si and a molecular weight of 424.57 g/mol. Its IUPAC name is (4R,4aR,8aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4a,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-6-one.
| Compound Name | (4R,4aR,8aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4a,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 10971944 |
| Molecular Formula | C24H28O5Si |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (4R,4aR,8aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4a,8a-dihydro-4H-pyrano[3,2-d][1,3]dioxin-6-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1OCO[C@H]2C=CC(=O)O[C@H]21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28O5Si/c1-24(2,3)30(18-10-6-4-7-11-18,19-12-8-5-9-13-19)28-16-21-23-20(26-17-27-21)14-15-22(25)29-23/h4-15,20-21,23H,16-17H2,1-3H3/t20-,21+,23+/m0/s1 |
| InChIKey | BTPPMJZMSADRRD-QZNHQXDQSA-N |
| XLogP | 2.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|