C22H28AlClO4Si — CID 134991651
[(3aR,4R,7aR)-2-chloro-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxalumolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 134991651) has the molecular formula C22H28AlClO4Si and a molecular weight of 446.98 g/mol. Its IUPAC name is [(3aR,4R,7aR)-2-chloro-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxalumolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,4R,7aR)-2-chloro-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxalumolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134991651 |
| Molecular Formula | C22H28AlClO4Si |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [(3aR,4R,7aR)-2-chloro-4,6,7,7a-tetrahydro-3aH-[1,3,2]dioxalumolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H]1OCC[C@H]2O[Al](Cl)O[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O4Si.Al.ClH/c1-22(2,3)27(17-10-6-4-7-11-17,18-12-8-5-9-13-18)26-16-20-21(24)19(23)14-15-25-20;;/h4-13,19-21H,14-16H2,1-3H3;;1H/q-2;+3;/p-1/t19-,20-,21+;;/m1../s1 |
| InChIKey | APDQEJQYNWALSB-DYIOVDSESA-M |
| XLogP | 3.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|