C26H31N3O8 — CID 137441909
[5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)cyclohexyl] 4-nitrobenzoate (PubChem CID 137441909) has the molecular formula C26H31N3O8 and a molecular weight of 513.55 g/mol. Its IUPAC name is [5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)cyclohexyl] 4-nitrobenzoate.
| Compound Name | [5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)cyclohexyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 137441909 |
| Molecular Formula | C26H31N3O8 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | [5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)cyclohexyl] 4-nitrobenzoate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(NC(=O)OCc2ccccc2)C(OC(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C26H31N3O8/c1-26(2,3)37-25(32)27-19-11-14-21(28-24(31)35-16-17-7-5-4-6-8-17)22(15-19)36-23(30)18-9-12-20(13-10-18)29(33)34/h4-10,12-13,19,21-22H,11,14-16H2,1-3H3,(H,27,32)(H,28,31) |
| InChIKey | VEFAEUGGKKPQSM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|