C25H39NO4 — CID 102400014
[(2R,3S,6R)-4-methylidene-2-[(1S)-1-phenylmethoxyethyl]-6-propyloxan-3-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 102400014) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is [(2R,3S,6R)-4-methylidene-2-[(1S)-1-phenylmethoxyethyl]-6-propyloxan-3-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(2R,3S,6R)-4-methylidene-2-[(1S)-1-phenylmethoxyethyl]-6-propyloxan-3-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 102400014 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | [(2R,3S,6R)-4-methylidene-2-[(1S)-1-phenylmethoxyethyl]-6-propyloxan-3-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | C=C1C[C@@H](CCC)O[C@H]([C@H](C)OCc2ccccc2)[C@H]1OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C25H39NO4/c1-8-12-22-15-19(6)23(30-25(27)26(17(2)3)18(4)5)24(29-22)20(7)28-16-21-13-10-9-11-14-21/h9-11,13-14,17-18,20,22-24H,6,8,12,15-16H2,1-5,7H3/t20-,22+,23-,24+/m0/s1 |
| InChIKey | RTINCWAUUMMADR-KELGSRBJSA-N |
| XLogP | 5.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|