C35H46O5 — CID 11364815
(2R,3R,4S,5S)-2-octoxy-3,4-bis(phenylmethoxy)-5-[(1R)-1-phenylmethoxyethyl]oxolane (PubChem CID 11364815) has the molecular formula C35H46O5 and a molecular weight of 546.75 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-octoxy-3,4-bis(phenylmethoxy)-5-[(1R)-1-phenylmethoxyethyl]oxolane.
| Compound Name | (2R,3R,4S,5S)-2-octoxy-3,4-bis(phenylmethoxy)-5-[(1R)-1-phenylmethoxyethyl]oxolane |
|---|---|
| PubChem CID | 11364815 |
| Molecular Formula | C35H46O5 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | (2R,3R,4S,5S)-2-octoxy-3,4-bis(phenylmethoxy)-5-[(1R)-1-phenylmethoxyethyl]oxolane |
| SMILES | CCCCCCCCO[C@@H]1O[C@@H]([C@@H](C)OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H46O5/c1-3-4-5-6-7-17-24-36-35-34(39-27-31-22-15-10-16-23-31)33(38-26-30-20-13-9-14-21-30)32(40-35)28(2)37-25-29-18-11-8-12-19-29/h8-16,18-23,28,32-35H,3-7,17,24-27H2,1-2H3/t28-,32+,33+,34-,35-/m1/s1 |
| InChIKey | ANJRQTPCQMVQEQ-AHBPHSMCSA-N |
| XLogP | 7.86 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|