C16H22O3 — CID 15360166
(2S,5S)-2-[(1S)-1-phenylmethoxyethyl]-5-propan-2-yloxolan-3-one (PubChem CID 15360166) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2S,5S)-2-[(1S)-1-phenylmethoxyethyl]-5-propan-2-yloxolan-3-one.
| Compound Name | (2S,5S)-2-[(1S)-1-phenylmethoxyethyl]-5-propan-2-yloxolan-3-one |
|---|---|
| PubChem CID | 15360166 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (2S,5S)-2-[(1S)-1-phenylmethoxyethyl]-5-propan-2-yloxolan-3-one |
| SMILES | CC(C)[C@@H]1CC(=O)[C@H]([C@H](C)OCc2ccccc2)O1 |
| InChI | InChI=1S/C16H22O3/c1-11(2)15-9-14(17)16(19-15)12(3)18-10-13-7-5-4-6-8-13/h4-8,11-12,15-16H,9-10H2,1-3H3/t12-,15-,16-/m0/s1 |
| InChIKey | BZUPJWOIKFXILA-RCBQFDQVSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |