C23H28O4 — CID 68861590
5-[1,2-bis(phenylmethoxy)ethyl]-3-propan-2-yloxolan-2-one (PubChem CID 68861590) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 5-[1,2-bis(phenylmethoxy)ethyl]-3-propan-2-yloxolan-2-one.
| Compound Name | 5-[1,2-bis(phenylmethoxy)ethyl]-3-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 68861590 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 5-[1,2-bis(phenylmethoxy)ethyl]-3-propan-2-yloxolan-2-one |
| SMILES | CC(C)C1CC(C(COCc2ccccc2)OCc2ccccc2)OC1=O |
| InChI | InChI=1S/C23H28O4/c1-17(2)20-13-21(27-23(20)24)22(26-15-19-11-7-4-8-12-19)16-25-14-18-9-5-3-6-10-18/h3-12,17,20-22H,13-16H2,1-2H3 |
| InChIKey | RSZZAKJQTAKYGG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |