C22H33NO5 — CID 69199249
tert-butyl N-methyl-N-[1-(5-oxo-4-propan-2-yloxolan-2-yl)-2-phenylmethoxyethyl]carbamate (PubChem CID 69199249) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-(5-oxo-4-propan-2-yloxolan-2-yl)-2-phenylmethoxyethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-(5-oxo-4-propan-2-yloxolan-2-yl)-2-phenylmethoxyethyl]carbamate |
|---|---|
| PubChem CID | 69199249 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | tert-butyl N-methyl-N-[1-(5-oxo-4-propan-2-yloxolan-2-yl)-2-phenylmethoxyethyl]carbamate |
| SMILES | CC(C)C1CC(C(COCc2ccccc2)N(C)C(=O)OC(C)(C)C)OC1=O |
| InChI | InChI=1S/C22H33NO5/c1-15(2)17-12-19(27-20(17)24)18(23(6)21(25)28-22(3,4)5)14-26-13-16-10-8-7-9-11-16/h7-11,15,17-19H,12-14H2,1-6H3 |
| InChIKey | AXUYTTVLOCMXKV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |