C23H34N4O5 — CID 173487975
tert-butyl N-[1-[3-[[2-azido-2-(5-oxo-4-propan-2-yloxolan-2-yl)ethoxy]methyl]phenyl]ethyl]carbamate (PubChem CID 173487975) has the molecular formula C23H34N4O5 and a molecular weight of 446.55 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[[2-azido-2-(5-oxo-4-propan-2-yloxolan-2-yl)ethoxy]methyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[[2-azido-2-(5-oxo-4-propan-2-yloxolan-2-yl)ethoxy]methyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 173487975 |
| Molecular Formula | C23H34N4O5 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | tert-butyl N-[1-[3-[[2-azido-2-(5-oxo-4-propan-2-yloxolan-2-yl)ethoxy]methyl]phenyl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1cccc(COCC(N=[N+]=[N-])C2CC(C(C)C)C(=O)O2)c1 |
| InChI | InChI=1S/C23H34N4O5/c1-14(2)18-11-20(31-21(18)28)19(26-27-24)13-30-12-16-8-7-9-17(10-16)15(3)25-22(29)32-23(4,5)6/h7-10,14-15,18-20H,11-13H2,1-6H3,(H,25,29) |
| InChIKey | CRGMGOUWHMWFRA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|