C23H37NO4 — CID 102213264
[(Z,4S,5R)-5-hydroxy-4-(2-phenylmethoxyethyl)hept-2-en-2-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 102213264) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is [(Z,4S,5R)-5-hydroxy-4-(2-phenylmethoxyethyl)hept-2-en-2-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z,4S,5R)-5-hydroxy-4-(2-phenylmethoxyethyl)hept-2-en-2-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 102213264 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | [(Z,4S,5R)-5-hydroxy-4-(2-phenylmethoxyethyl)hept-2-en-2-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC[C@@H](O)[C@H](/C=C(/C)OC(=O)N(C(C)C)C(C)C)CCOCc1ccccc1 |
| InChI | InChI=1S/C23H37NO4/c1-7-22(25)21(13-14-27-16-20-11-9-8-10-12-20)15-19(6)28-23(26)24(17(2)3)18(4)5/h8-12,15,17-18,21-22,25H,7,13-14,16H2,1-6H3/b19-15-/t21-,22+/m0/s1 |
| InChIKey | OVTDZMAXPQZEJQ-SVLMMEPOSA-N |
| XLogP | 5.14 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|