C16H26O2 — CID 159280179
(3S)-5-methyl-1-[(2S,5S)-3-methylidene-5-propyloxolan-2-yl]hepta-5,6-dien-3-ol (PubChem CID 159280179) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (3S)-5-methyl-1-[(2S,5S)-3-methylidene-5-propyloxolan-2-yl]hepta-5,6-dien-3-ol.
| Compound Name | (3S)-5-methyl-1-[(2S,5S)-3-methylidene-5-propyloxolan-2-yl]hepta-5,6-dien-3-ol |
|---|---|
| PubChem CID | 159280179 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (3S)-5-methyl-1-[(2S,5S)-3-methylidene-5-propyloxolan-2-yl]hepta-5,6-dien-3-ol |
| SMILES | C=C=C(C)C[C@@H](O)CC[C@@H]1O[C@@H](CCC)CC1=C |
| InChI | InChI=1S/C16H26O2/c1-5-7-15-11-13(4)16(18-15)9-8-14(17)10-12(3)6-2/h14-17H,2,4-5,7-11H2,1,3H3/t14-,15-,16-/m0/s1 |
| InChIKey | VBWMVUIZRXHQHG-JYJNAYRXSA-N |
| XLogP | 3.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|