C17H26F3IO6S — CID 58370586
[(3R)-4-[(2S,3aS,5R,7aS)-2-(3-hydroxypropyl)-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate (PubChem CID 58370586) has the molecular formula C17H26F3IO6S and a molecular weight of 542.35 g/mol. Its IUPAC name is [(3R)-4-[(2S,3aS,5R,7aS)-2-(3-hydroxypropyl)-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate.
| Compound Name | [(3R)-4-[(2S,3aS,5R,7aS)-2-(3-hydroxypropyl)-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58370586 |
| Molecular Formula | C17H26F3IO6S |
| Molecular Weight | 542.35 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | [(3R)-4-[(2S,3aS,5R,7aS)-2-(3-hydroxypropyl)-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-3-methylbut-1-en-2-yl] trifluoromethanesulfonate |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)[C@H](C)C[C@H]1CC[C@@H]2O[C@@H](CCCO)C[C@]2(CI)O1 |
| InChI | InChI=1S/C17H26F3IO6S/c1-11(12(2)27-28(23,24)17(18,19)20)8-13-5-6-15-16(10-21,26-13)9-14(25-15)4-3-7-22/h11,13-15,22H,2-10H2,1H3/t11-,13-,14+,15+,16-/m1/s1 |
| InChIKey | ZSUOCIJRCWWLHF-NZBFACKJSA-N |
| XLogP | 3.68 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|