C29H48I3NO4 — CID 159885027
(2S,7aS)-2-butyl-3a-(iodomethyl)-5-(2-isocyanoethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran;(2S,7aS)-2-butyl-5-(2-iodoethyl)-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran (PubChem CID 159885027) has the molecular formula C29H48I3NO4 and a molecular weight of 855.42 g/mol. Its IUPAC name is (2S,7aS)-2-butyl-3a-(iodomethyl)-5-(2-isocyanoethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran;(2S,7aS)-2-butyl-5-(2-iodoethyl)-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran.
| Compound Name | (2S,7aS)-2-butyl-3a-(iodomethyl)-5-(2-isocyanoethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran;(2S,7aS)-2-butyl-5-(2-iodoethyl)-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran |
|---|---|
| PubChem CID | 159885027 |
| Molecular Formula | C29H48I3NO4 |
| Molecular Weight | 855.42 g/mol |
| Exact Mass | 855.07 |
| IUPAC Name | (2S,7aS)-2-butyl-3a-(iodomethyl)-5-(2-isocyanoethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran;(2S,7aS)-2-butyl-5-(2-iodoethyl)-3a-(iodomethyl)-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran |
| SMILES | CCCC[C@H]1CC2(CI)OC(CCI)CC[C@@H]2O1.[C-]#[N+]CCC1CC[C@@H]2O[C@@H](CCCC)CC2(CI)O1 |
| InChI | InChI=1S/C15H24INO2.C14H24I2O2/c1-3-4-5-13-10-15(11-16)14(18-13)7-6-12(19-15)8-9-17-2;1-2-3-4-12-9-14(10-16)13(17-12)6-5-11(18-14)7-8-15/h12-14H,3-11H2,1H3;11-13H,2-10H2,1H3/t12?,13-,14-,15?;11?,12-,13-,14?/m00/s1 |
| InChIKey | NUAFXZKGLOGKCD-JKIPZTDGSA-N |
| XLogP | 8.51 |
| TPSA | 41.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.42 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|