C21H17F3N2O2S — CID 53230438
N-[(4-methylphenyl)-oxo-[4-(trifluoromethyl)anilino]-λ6-sulfanylidene]benzamide (PubChem CID 53230438) has the molecular formula C21H17F3N2O2S and a molecular weight of 418.44 g/mol. Its IUPAC name is N-[(4-methylphenyl)-oxo-[4-(trifluoromethyl)anilino]-λ6-sulfanylidene]benzamide.
| Compound Name | N-[(4-methylphenyl)-oxo-[4-(trifluoromethyl)anilino]-λ6-sulfanylidene]benzamide |
|---|---|
| PubChem CID | 53230438 |
| Molecular Formula | C21H17F3N2O2S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | N-[(4-methylphenyl)-oxo-[4-(trifluoromethyl)anilino]-λ6-sulfanylidene]benzamide |
| SMILES | Cc1ccc(S(=O)(=NC(=O)c2ccccc2)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H17F3N2O2S/c1-15-7-13-19(14-8-15)29(28,26-20(27)16-5-3-2-4-6-16)25-18-11-9-17(10-12-18)21(22,23)24/h2-14H,1H3,(H,25,26,27,28) |
| InChIKey | BOAAUMXYMKSVQW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |