C18H22N2O2S — CID 135011515
N-[butylamino-(4-methylphenyl)-oxo-λ6-sulfanylidene]benzamide (PubChem CID 135011515) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is N-[butylamino-(4-methylphenyl)-oxo-λ6-sulfanylidene]benzamide.
| Compound Name | N-[butylamino-(4-methylphenyl)-oxo-λ6-sulfanylidene]benzamide |
|---|---|
| PubChem CID | 135011515 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-[butylamino-(4-methylphenyl)-oxo-λ6-sulfanylidene]benzamide |
| SMILES | CCCCNS(=O)(=NC(=O)c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22N2O2S/c1-3-4-14-19-23(22,17-12-10-15(2)11-13-17)20-18(21)16-8-6-5-7-9-16/h5-13H,3-4,14H2,1-2H3,(H,19,20,21,22) |
| InChIKey | KFSJQVCAFVGTKH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|