C18H22ClN3O2S — CID 10571795
1-[butylamino-(4-methylphenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea (PubChem CID 10571795) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 1-[butylamino-(4-methylphenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[butylamino-(4-methylphenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 10571795 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-[butylamino-(4-methylphenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea |
| SMILES | CCCCNS(=O)(=NC(=O)Nc1ccc(Cl)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22ClN3O2S/c1-3-4-13-20-25(24,17-11-5-14(2)6-12-17)22-18(23)21-16-9-7-15(19)8-10-16/h5-12H,3-4,13H2,1-2H3,(H2,20,21,22,23,24) |
| InChIKey | BOGVYKXJZXYCFS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|