C14H12Cl2N2O2S — CID 10688715
1-[chloro-(4-methylphenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea (PubChem CID 10688715) has the molecular formula C14H12Cl2N2O2S and a molecular weight of 343.24 g/mol. Its IUPAC name is 1-[chloro-(4-methylphenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[chloro-(4-methylphenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 10688715 |
| Molecular Formula | C14H12Cl2N2O2S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 1-[chloro-(4-methylphenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea |
| SMILES | Cc1ccc(S(=O)(Cl)=NC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H12Cl2N2O2S/c1-10-2-8-13(9-3-10)21(16,20)18-14(19)17-12-6-4-11(15)5-7-12/h2-9H,1H3,(H,17,19) |
| InChIKey | UXRLHOXWNYGLDY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |