C17H20ClN3O2S — CID 10761364
1-(4-chlorophenyl)-3-[(4-methylphenyl)-oxo-(propan-2-ylamino)-λ6-sulfanylidene]urea (PubChem CID 10761364) has the molecular formula C17H20ClN3O2S and a molecular weight of 365.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(4-methylphenyl)-oxo-(propan-2-ylamino)-λ6-sulfanylidene]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(4-methylphenyl)-oxo-(propan-2-ylamino)-λ6-sulfanylidene]urea |
|---|---|
| PubChem CID | 10761364 |
| Molecular Formula | C17H20ClN3O2S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(4-methylphenyl)-oxo-(propan-2-ylamino)-λ6-sulfanylidene]urea |
| SMILES | Cc1ccc(S(=O)(=NC(=O)Nc2ccc(Cl)cc2)NC(C)C)cc1 |
| InChI | InChI=1S/C17H20ClN3O2S/c1-12(2)20-24(23,16-10-4-13(3)5-11-16)21-17(22)19-15-8-6-14(18)7-9-15/h4-12H,1-3H3,(H2,19,20,21,22,23) |
| InChIKey | JWPLNQXQVGEYRP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |