About 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea
1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea (PubChem CID 11796026) has the molecular formula C21H20ClN3O2S
and a molecular weight of 413.93 g/mol. Its IUPAC name is 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea.
Molecular Properties
| Compound Name | 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea |
| PubChem CID | 11796026 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea |
| SMILES | Cc1ccc(S(=O)(=NC(=O)NCc2ccccc2)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H20ClN3O2S/c1-16-7-13-20(14-8-16)28(27,24-19-11-9-18(22)10-12-19)25-21(26)23-15-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H2,23,24,25,26,27) |
| InChIKey | JIMYYDMMUZTJAB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea?
The IUPAC name of 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea (CID 11796026) is 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea.
What is the SMILES notation for 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea?
The canonical SMILES for 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea is Cc1ccc(S(=O)(=NC(=O)NCc2ccccc2)Nc2ccc(Cl)cc2)cc1.
What is the InChIKey of 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea?
The InChIKey is JIMYYDMMUZTJAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20ClN3O2S/c1-16-7-13-20(14-8-16)28(27,24-19-11-9-18(22)10-12-19)25-21(26)23-15-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H2,23,24,25,26,27).
What are the key properties of 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea?
1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea has a molecular weight of 413.93 g/mol, XLogP of 5.41, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea is sourced from PubChem (CID 11796026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).