C21H20ClN3O2S — CID 11796026
1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea (PubChem CID 11796026) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea.
| Compound Name | 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea |
|---|---|
| PubChem CID | 11796026 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-benzyl-3-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]urea |
| SMILES | Cc1ccc(S(=O)(=NC(=O)NCc2ccccc2)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H20ClN3O2S/c1-16-7-13-20(14-8-16)28(27,24-19-11-9-18(22)10-12-19)25-21(26)23-15-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H2,23,24,25,26,27) |
| InChIKey | JIMYYDMMUZTJAB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |