C14H14ClN3O3S — CID 10735870
[(4-chloroanilino)-[4-(hydroxymethyl)phenyl]-oxo-lambda6-sulfanylidene]urea (PubChem CID 10735870) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is [(4-chloroanilino)-[4-(hydroxymethyl)phenyl]-oxo-lambda6-sulfanylidene]urea.
| Compound Name | [(4-chloroanilino)-[4-(hydroxymethyl)phenyl]-oxo-lambda6-sulfanylidene]urea |
|---|---|
| PubChem CID | 10735870 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | [(4-chloroanilino)-[4-(hydroxymethyl)phenyl]-oxo-lambda6-sulfanylidene]urea |
| SMILES | NC(=O)N=S(=O)(Nc1ccc(Cl)cc1)c1ccc(CO)cc1 |
| InChI | InChI=1S/C14H14ClN3O3S/c15-11-3-5-12(6-4-11)17-22(21,18-14(16)20)13-7-1-10(9-19)2-8-13/h1-8,19H,9H2,(H3,16,17,18,20,21) |
| InChIKey | BGIDWYRCVQKUIG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |