C14H13Cl2N3O2S — CID 10570349
[(3,4-dichloroanilino)-(4-methylphenyl)-oxo-lambda6-sulfanylidene]urea (PubChem CID 10570349) has the molecular formula C14H13Cl2N3O2S and a molecular weight of 358.25 g/mol. Its IUPAC name is [(3,4-dichloroanilino)-(4-methylphenyl)-oxo-lambda6-sulfanylidene]urea.
| Compound Name | [(3,4-dichloroanilino)-(4-methylphenyl)-oxo-lambda6-sulfanylidene]urea |
|---|---|
| PubChem CID | 10570349 |
| Molecular Formula | C14H13Cl2N3O2S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | [(3,4-dichloroanilino)-(4-methylphenyl)-oxo-lambda6-sulfanylidene]urea |
| SMILES | Cc1ccc(S(=O)(=NC(N)=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C14H13Cl2N3O2S/c1-9-2-5-11(6-3-9)22(21,19-14(17)20)18-10-4-7-12(15)13(16)8-10/h2-8H,1H3,(H3,17,18,19,20,21) |
| InChIKey | ZJPBTYSVUFBRAD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |