C17H18ClN3O2S — CID 10642499
1-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]-3-prop-2-enylurea (PubChem CID 10642499) has the molecular formula C17H18ClN3O2S and a molecular weight of 363.87 g/mol. Its IUPAC name is 1-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]-3-prop-2-enylurea.
| Compound Name | 1-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 10642499 |
| Molecular Formula | C17H18ClN3O2S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-[(4-chloroanilino)-(4-methylphenyl)-oxo-λ6-sulfanylidene]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)N=S(=O)(Nc1ccc(Cl)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H18ClN3O2S/c1-3-12-19-17(22)21-24(23,16-10-4-13(2)5-11-16)20-15-8-6-14(18)7-9-15/h3-11H,1,12H2,2H3,(H2,19,20,21,22,23) |
| InChIKey | BBIXYTGWZFCXLN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|