C13H11BrClN3O2S — CID 10572384
1-[amino-(4-bromophenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea (PubChem CID 10572384) has the molecular formula C13H11BrClN3O2S and a molecular weight of 388.67 g/mol. Its IUPAC name is 1-[amino-(4-bromophenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[amino-(4-bromophenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 10572384 |
| Molecular Formula | C13H11BrClN3O2S |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 386.94 |
| IUPAC Name | 1-[amino-(4-bromophenyl)-oxo-lambda6-sulfanylidene]-3-(4-chlorophenyl)urea |
| SMILES | NS(=O)(=NC(=O)Nc1ccc(Cl)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H11BrClN3O2S/c14-9-1-7-12(8-2-9)21(16,20)18-13(19)17-11-5-3-10(15)4-6-11/h1-8H,(H3,16,17,18,19,20) |
| InChIKey | VODBTSQLPXGBCP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |