C22H17FINO2S — CID 154594138
(NE)-N-[(E)-1-(4-fluorophenyl)-3-(4-iodophenyl)prop-2-enylidene]-4-methylbenzenesulfonamide (PubChem CID 154594138) has the molecular formula C22H17FINO2S and a molecular weight of 505.35 g/mol. Its IUPAC name is (NE)-N-[(E)-1-(4-fluorophenyl)-3-(4-iodophenyl)prop-2-enylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[(E)-1-(4-fluorophenyl)-3-(4-iodophenyl)prop-2-enylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 154594138 |
| Molecular Formula | C22H17FINO2S |
| Molecular Weight | 505.35 g/mol |
| Exact Mass | 505.00 |
| IUPAC Name | (NE)-N-[(E)-1-(4-fluorophenyl)-3-(4-iodophenyl)prop-2-enylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(\C=C\c2ccc(I)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H17FINO2S/c1-16-2-13-21(14-3-16)28(26,27)25-22(18-7-9-19(23)10-8-18)15-6-17-4-11-20(24)12-5-17/h2-15H,1H3/b15-6+,25-22+ |
| InChIKey | IGVAUKWYRUTOLY-UPWIAWBISA-N |
| XLogP | 5.63 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|