C26H24BrN3O2S — CID 154594308
(NE)-N-[(E)-1-(4-bromophenyl)-3-[4-[2-cyanoethyl(methyl)amino]phenyl]prop-2-enylidene]-4-methylbenzenesulfonamide (PubChem CID 154594308) has the molecular formula C26H24BrN3O2S and a molecular weight of 522.47 g/mol. Its IUPAC name is (NE)-N-[(E)-1-(4-bromophenyl)-3-[4-[2-cyanoethyl(methyl)amino]phenyl]prop-2-enylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NE)-N-[(E)-1-(4-bromophenyl)-3-[4-[2-cyanoethyl(methyl)amino]phenyl]prop-2-enylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 154594308 |
| Molecular Formula | C26H24BrN3O2S |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | (NE)-N-[(E)-1-(4-bromophenyl)-3-[4-[2-cyanoethyl(methyl)amino]phenyl]prop-2-enylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(\C=C\c2ccc(N(C)CCC#N)cc2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C26H24BrN3O2S/c1-20-4-15-25(16-5-20)33(31,32)29-26(22-9-11-23(27)12-10-22)17-8-21-6-13-24(14-7-21)30(2)19-3-18-28/h4-17H,3,19H2,1-2H3/b17-8+,29-26+ |
| InChIKey | PUDZZJFNZZHRPW-ILKXMJLZSA-N |
| XLogP | 6.00 |
| TPSA | 73.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|