C19H16N2O4S — CID 135071488
methyl (E,4E)-4-(4-cyanophenyl)-4-(4-methylphenyl)sulfonyliminobut-2-enoate (PubChem CID 135071488) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is methyl (E,4E)-4-(4-cyanophenyl)-4-(4-methylphenyl)sulfonyliminobut-2-enoate.
| Compound Name | methyl (E,4E)-4-(4-cyanophenyl)-4-(4-methylphenyl)sulfonyliminobut-2-enoate |
|---|---|
| PubChem CID | 135071488 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | methyl (E,4E)-4-(4-cyanophenyl)-4-(4-methylphenyl)sulfonyliminobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=N\S(=O)(=O)c1ccc(C)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H16N2O4S/c1-14-3-9-17(10-4-14)26(23,24)21-18(11-12-19(22)25-2)16-7-5-15(13-20)6-8-16/h3-12H,1-2H3/b12-11+,21-18+ |
| InChIKey | WAQQGSMOWDCMOH-QMGANLPRSA-N |
| XLogP | 2.77 |
| TPSA | 96.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|