C26H21NO2S — CID 139236527
(NZ)-4-methyl-N-[(E)-3-naphthalen-1-yl-1-phenylprop-2-enylidene]benzenesulfonamide (PubChem CID 139236527) has the molecular formula C26H21NO2S and a molecular weight of 411.53 g/mol. Its IUPAC name is (NZ)-4-methyl-N-[(E)-3-naphthalen-1-yl-1-phenylprop-2-enylidene]benzenesulfonamide.
| Compound Name | (NZ)-4-methyl-N-[(E)-3-naphthalen-1-yl-1-phenylprop-2-enylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 139236527 |
| Molecular Formula | C26H21NO2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (NZ)-4-methyl-N-[(E)-3-naphthalen-1-yl-1-phenylprop-2-enylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(/C=C/c2cccc3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21NO2S/c1-20-14-17-24(18-15-20)30(28,29)27-26(23-9-3-2-4-10-23)19-16-22-12-7-11-21-8-5-6-13-25(21)22/h2-19H,1H3/b19-16+,27-26- |
| InChIKey | DNRPDCOYWLTFBG-ZCXLWEBDSA-N |
| XLogP | 6.04 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|