C23H23N3O3S — CID 76558877
2-[4-(4-cyano-4-isocyano-3-methylbuta-1,3-dienyl)-N-methylanilino]ethyl 4-methylbenzenesulfonate (PubChem CID 76558877) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[4-(4-cyano-4-isocyano-3-methylbuta-1,3-dienyl)-N-methylanilino]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-(4-cyano-4-isocyano-3-methylbuta-1,3-dienyl)-N-methylanilino]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 76558877 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-[4-(4-cyano-4-isocyano-3-methylbuta-1,3-dienyl)-N-methylanilino]ethyl 4-methylbenzenesulfonate |
| SMILES | [C-]#[N+]C(C#N)=C(C)C=Cc1ccc(N(C)CCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O3S/c1-18-5-13-22(14-6-18)30(27,28)29-16-15-26(4)21-11-9-20(10-12-21)8-7-19(2)23(17-24)25-3/h5-14H,15-16H2,1-2,4H3 |
| InChIKey | NKHWDFHQBXLGCP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|