C24H25N3O3S — CID 155583128
2-[methyl-[2-(4-methylphenyl)imidazo[1,2-a]pyridin-7-yl]amino]ethyl 4-methylbenzenesulfonate (PubChem CID 155583128) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-[methyl-[2-(4-methylphenyl)imidazo[1,2-a]pyridin-7-yl]amino]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[methyl-[2-(4-methylphenyl)imidazo[1,2-a]pyridin-7-yl]amino]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 155583128 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-[methyl-[2-(4-methylphenyl)imidazo[1,2-a]pyridin-7-yl]amino]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(-c2cn3ccc(N(C)CCOS(=O)(=O)c4ccc(C)cc4)cc3n2)cc1 |
| InChI | InChI=1S/C24H25N3O3S/c1-18-4-8-20(9-5-18)23-17-27-13-12-21(16-24(27)25-23)26(3)14-15-30-31(28,29)22-10-6-19(2)7-11-22/h4-13,16-17H,14-15H2,1-3H3 |
| InChIKey | GMQCVTCRWSSJFC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|