C21H26N4O — CID 10360549
7-methyl-2-[4-(3-piperazin-1-ylpropoxy)phenyl]imidazo[1,2-a]pyridine (PubChem CID 10360549) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 7-methyl-2-[4-(3-piperazin-1-ylpropoxy)phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 7-methyl-2-[4-(3-piperazin-1-ylpropoxy)phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 10360549 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 7-methyl-2-[4-(3-piperazin-1-ylpropoxy)phenyl]imidazo[1,2-a]pyridine |
| SMILES | Cc1ccn2cc(-c3ccc(OCCCN4CCNCC4)cc3)nc2c1 |
| InChI | InChI=1S/C21H26N4O/c1-17-7-11-25-16-20(23-21(25)15-17)18-3-5-19(6-4-18)26-14-2-10-24-12-8-22-9-13-24/h3-7,11,15-16,22H,2,8-10,12-14H2,1H3 |
| InChIKey | YFXGBZUEGAWESW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|