C19H25N3O2 — CID 59651971
5-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]-1H-pyridazin-6-one (PubChem CID 59651971) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 5-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]-1H-pyridazin-6-one.
| Compound Name | 5-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 59651971 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 5-methyl-3-[4-(3-piperidin-1-ylpropoxy)phenyl]-1H-pyridazin-6-one |
| SMILES | Cc1cc(-c2ccc(OCCCN3CCCCC3)cc2)n[nH]c1=O |
| InChI | InChI=1S/C19H25N3O2/c1-15-14-18(20-21-19(15)23)16-6-8-17(9-7-16)24-13-5-12-22-10-3-2-4-11-22/h6-9,14H,2-5,10-13H2,1H3,(H,21,23) |
| InChIKey | ZXNQAPWNWNINQT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|