C27H35N3O2 — CID 163681744
4-methyl-2-[(6-methylcyclohexa-2,4-dien-1-yl)methyl]-6-[4-(3-piperidin-1-ylpropoxy)phenyl]pyridazin-3-one (PubChem CID 163681744) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 4-methyl-2-[(6-methylcyclohexa-2,4-dien-1-yl)methyl]-6-[4-(3-piperidin-1-ylpropoxy)phenyl]pyridazin-3-one.
| Compound Name | 4-methyl-2-[(6-methylcyclohexa-2,4-dien-1-yl)methyl]-6-[4-(3-piperidin-1-ylpropoxy)phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 163681744 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 4-methyl-2-[(6-methylcyclohexa-2,4-dien-1-yl)methyl]-6-[4-(3-piperidin-1-ylpropoxy)phenyl]pyridazin-3-one |
| SMILES | Cc1cc(-c2ccc(OCCCN3CCCCC3)cc2)nn(CC2C=CC=CC2C)c1=O |
| InChI | InChI=1S/C27H35N3O2/c1-21-9-4-5-10-24(21)20-30-27(31)22(2)19-26(28-30)23-11-13-25(14-12-23)32-18-8-17-29-15-6-3-7-16-29/h4-5,9-14,19,21,24H,3,6-8,15-18,20H2,1-2H3 |
| InChIKey | JLKGIYXKVUWTJX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|