C26H31N3O2 — CID 59651922
4-benzyl-2-methyl-6-[4-(3-piperidin-1-ylpropoxy)phenyl]pyridazin-3-one (PubChem CID 59651922) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-benzyl-2-methyl-6-[4-(3-piperidin-1-ylpropoxy)phenyl]pyridazin-3-one.
| Compound Name | 4-benzyl-2-methyl-6-[4-(3-piperidin-1-ylpropoxy)phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 59651922 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 4-benzyl-2-methyl-6-[4-(3-piperidin-1-ylpropoxy)phenyl]pyridazin-3-one |
| SMILES | Cn1nc(-c2ccc(OCCCN3CCCCC3)cc2)cc(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C26H31N3O2/c1-28-26(30)23(19-21-9-4-2-5-10-21)20-25(27-28)22-11-13-24(14-12-22)31-18-8-17-29-15-6-3-7-16-29/h2,4-5,9-14,20H,3,6-8,15-19H2,1H3 |
| InChIKey | IAYXKTJDTHBVJU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|