C26H33N3O — CID 123635910
4-benzyl-2-methyl-6-[4-(3-piperidin-1-ylpropoxy)phenyl]-3H-pyridazine (PubChem CID 123635910) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is 4-benzyl-2-methyl-6-[4-(3-piperidin-1-ylpropoxy)phenyl]-3H-pyridazine.
| Compound Name | 4-benzyl-2-methyl-6-[4-(3-piperidin-1-ylpropoxy)phenyl]-3H-pyridazine |
|---|---|
| PubChem CID | 123635910 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 4-benzyl-2-methyl-6-[4-(3-piperidin-1-ylpropoxy)phenyl]-3H-pyridazine |
| SMILES | CN1CC(Cc2ccccc2)=CC(c2ccc(OCCCN3CCCCC3)cc2)=N1 |
| InChI | InChI=1S/C26H33N3O/c1-28-21-23(19-22-9-4-2-5-10-22)20-26(27-28)24-11-13-25(14-12-24)30-18-8-17-29-15-6-3-7-16-29/h2,4-5,9-14,20H,3,6-8,15-19,21H2,1H3 |
| InChIKey | XWLWZUFBXIUBDZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|