C19H18ClNO4S — CID 154711088
ethyl (E,2Z)-4-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyliminobut-3-enoate (PubChem CID 154711088) has the molecular formula C19H18ClNO4S and a molecular weight of 391.88 g/mol. Its IUPAC name is ethyl (E,2Z)-4-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyliminobut-3-enoate.
| Compound Name | ethyl (E,2Z)-4-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyliminobut-3-enoate |
|---|---|
| PubChem CID | 154711088 |
| Molecular Formula | C19H18ClNO4S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | ethyl (E,2Z)-4-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyliminobut-3-enoate |
| SMILES | CCOC(=O)C(/C=C/c1ccc(Cl)cc1)=N\S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H18ClNO4S/c1-3-25-19(22)18(13-8-15-6-9-16(20)10-7-15)21-26(23,24)17-11-4-14(2)5-12-17/h4-13H,3H2,1-2H3/b13-8+,21-18- |
| InChIKey | FHVCJYWAMSFAMT-QKVZCINJSA-N |
| XLogP | 4.05 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|