C20H21NO4S — CID 139201593
ethyl (E,2Z)-4-(4-methylphenyl)-2-(4-methylphenyl)sulfonyliminobut-3-enoate (PubChem CID 139201593) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is ethyl (E,2Z)-4-(4-methylphenyl)-2-(4-methylphenyl)sulfonyliminobut-3-enoate.
| Compound Name | ethyl (E,2Z)-4-(4-methylphenyl)-2-(4-methylphenyl)sulfonyliminobut-3-enoate |
|---|---|
| PubChem CID | 139201593 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | ethyl (E,2Z)-4-(4-methylphenyl)-2-(4-methylphenyl)sulfonyliminobut-3-enoate |
| SMILES | CCOC(=O)C(/C=C/c1ccc(C)cc1)=N\S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO4S/c1-4-25-20(22)19(14-11-17-9-5-15(2)6-10-17)21-26(23,24)18-12-7-16(3)8-13-18/h5-14H,4H2,1-3H3/b14-11+,21-19- |
| InChIKey | CBZFRXGLFASNLO-WBHHTMABSA-N |
| XLogP | 3.71 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|