C18H22N2O3S — CID 138975302
ethyl N-(2,6-dimethylphenyl)-N'-(4-methylphenyl)sulfonylcarbamimidate (PubChem CID 138975302) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is ethyl N-(2,6-dimethylphenyl)-N'-(4-methylphenyl)sulfonylcarbamimidate.
| Compound Name | ethyl N-(2,6-dimethylphenyl)-N'-(4-methylphenyl)sulfonylcarbamimidate |
|---|---|
| PubChem CID | 138975302 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | ethyl N-(2,6-dimethylphenyl)-N'-(4-methylphenyl)sulfonylcarbamimidate |
| SMILES | CCO/C(=N/S(=O)(=O)c1ccc(C)cc1)Nc1c(C)cccc1C |
| InChI | InChI=1S/C18H22N2O3S/c1-5-23-18(19-17-14(3)7-6-8-15(17)4)20-24(21,22)16-11-9-13(2)10-12-16/h6-12H,5H2,1-4H3,(H,19,20) |
| InChIKey | WAWOXCHARBNPKT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|